C20H20FN3O6S — CID 41081758
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (2S)-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 41081758) has the molecular formula C20H20FN3O6S and a molecular weight of 449.46 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (2S)-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (2S)-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 41081758 |
| Molecular Formula | C20H20FN3O6S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (2S)-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | Cc1ccc(NC(=O)CS[C@@H](C)C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2F)cc1 |
| InChI | InChI=1S/C20H20FN3O6S/c1-12-3-5-14(6-4-12)22-19(26)11-31-13(2)20(27)30-10-18(25)23-17-9-15(24(28)29)7-8-16(17)21/h3-9,13H,10-11H2,1-2H3,(H,22,26)(H,23,25)/t13-/m0/s1 |
| InChIKey | VGCDOCLQIIMSDN-ZDUSSCGKSA-N |
| XLogP | 3.28 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|