C21H22FN3O6S — CID 41170191
[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 41170191) has the molecular formula C21H22FN3O6S and a molecular weight of 463.49 g/mol. Its IUPAC name is [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 41170191 |
| Molecular Formula | C21H22FN3O6S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | Cc1cc(NC(=O)COC(=O)[C@H](C)SCC(=O)Nc2ccc(F)cc2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H22FN3O6S/c1-12-8-17(18(25(29)30)9-13(12)2)24-19(26)10-31-21(28)14(3)32-11-20(27)23-16-6-4-15(22)5-7-16/h4-9,14H,10-11H2,1-3H3,(H,23,27)(H,24,26)/t14-/m0/s1 |
| InChIKey | HAXHKQZBYDTDCF-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|