C26H30N4O3 — CID 41088709
2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide (PubChem CID 41088709) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide.
| Compound Name | 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 41088709 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide |
| SMILES | O=C(CN1CC[C@@H]2CCCC[C@@H]2C1)NN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H30N4O3/c31-23(18-29-16-15-19-9-7-8-10-20(19)17-29)28-30-24(32)26(27-25(30)33,21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-6,11-14,19-20H,7-10,15-18H2,(H,27,33)(H,28,31)/t19-,20+/m0/s1 |
| InChIKey | AOVXLKFCLQDBIE-VQTJNVASSA-N |
| XLogP | 3.03 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|