C25H24N2O5 — CID 41090476
N-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 41090476) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 41090476 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NC[C@H](O)COCc3ccco3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-30-19-10-8-17(9-11-19)24-13-22(21-6-2-3-7-23(21)27-24)25(29)26-14-18(28)15-31-16-20-5-4-12-32-20/h2-13,18,28H,14-16H2,1H3,(H,26,29)/t18-/m0/s1 |
| InChIKey | VEWPYDSRUGMUOW-SFHVURJKSA-N |
| XLogP | 3.81 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |