C23H28N2O4S2 — CID 41091111
(3aR,6aS)-3-[(3,4-dimethoxyphenyl)methyl]-2-(3-phenylpropylsulfanyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 41091111) has the molecular formula C23H28N2O4S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is (3aR,6aS)-3-[(3,4-dimethoxyphenyl)methyl]-2-(3-phenylpropylsulfanyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aR,6aS)-3-[(3,4-dimethoxyphenyl)methyl]-2-(3-phenylpropylsulfanyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 41091111 |
| Molecular Formula | C23H28N2O4S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (3aR,6aS)-3-[(3,4-dimethoxyphenyl)methyl]-2-(3-phenylpropylsulfanyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | COc1ccc(CN2C(SCCCc3ccccc3)=N[C@@H]3CS(=O)(=O)C[C@@H]32)cc1OC |
| InChI | InChI=1S/C23H28N2O4S2/c1-28-21-11-10-18(13-22(21)29-2)14-25-20-16-31(26,27)15-19(20)24-23(25)30-12-6-9-17-7-4-3-5-8-17/h3-5,7-8,10-11,13,19-20H,6,9,12,14-16H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | TXERJNZRCSFHMJ-UXHICEINSA-N |
| XLogP | 3.41 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|