C16H15Cl2N3O3S2 — CID 41091401
N-[(3aR,6aS)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclopropanecarboxamide (PubChem CID 41091401) has the molecular formula C16H15Cl2N3O3S2 and a molecular weight of 432.35 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclopropanecarboxamide.
| Compound Name | N-[(3aR,6aS)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 41091401 |
| Molecular Formula | C16H15Cl2N3O3S2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | N-[(3aR,6aS)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclopropanecarboxamide |
| SMILES | O=C(/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1/N=C\c1ccc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C16H15Cl2N3O3S2/c17-11-4-3-10(12(18)5-11)6-19-21-13-7-26(23,24)8-14(13)25-16(21)20-15(22)9-1-2-9/h3-6,9,13-14H,1-2,7-8H2/b19-6-,20-16-/t13-,14-/m1/s1 |
| InChIKey | VYYWZNBJTXOEIM-YMLGYGJNSA-N |
| XLogP | 2.83 |
| TPSA | 79.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|