C26H31NO7 — CID 41092609
3-[bis[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]phenol (PubChem CID 41092609) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is 3-[bis[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]phenol.
| Compound Name | 3-[bis[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]phenol |
|---|---|
| PubChem CID | 41092609 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-[bis[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]phenol |
| SMILES | COc1ccc(OC[C@@H](O)CN(C[C@H](O)COc2ccc(OC)cc2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C26H31NO7/c1-31-23-6-10-25(11-7-23)33-17-21(29)15-27(19-4-3-5-20(28)14-19)16-22(30)18-34-26-12-8-24(32-2)9-13-26/h3-14,21-22,28-30H,15-18H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | GUMHGLZFELHKGS-VXKWHMMOSA-N |
| XLogP | 3.10 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |