C16H16N4O2 — CID 41104588
(7aS)-2-[(3-methylquinoxalin-2-yl)methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 41104588) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is (7aS)-2-[(3-methylquinoxalin-2-yl)methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7aS)-2-[(3-methylquinoxalin-2-yl)methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 41104588 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (7aS)-2-[(3-methylquinoxalin-2-yl)methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | Cc1nc2ccccc2nc1CN1C(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C16H16N4O2/c1-10-13(18-12-6-3-2-5-11(12)17-10)9-20-15(21)14-7-4-8-19(14)16(20)22/h2-3,5-6,14H,4,7-9H2,1H3/t14-/m0/s1 |
| InChIKey | NSSZHFMRGIPITR-AWEZNQCLSA-N |
| XLogP | 1.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|