C22H19BrClNO4 — CID 41123691
(4S,7R)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-(2-chlorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 41123691) has the molecular formula C22H19BrClNO4 and a molecular weight of 476.75 g/mol. Its IUPAC name is (4S,7R)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-(2-chlorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4S,7R)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-(2-chlorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 41123691 |
| Molecular Formula | C22H19BrClNO4 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | (4S,7R)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-(2-chlorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1cc([C@@H]2CC(=O)NC3=C2C(=O)C[C@H](c2ccccc2Cl)C3)cc(Br)c1O |
| InChI | InChI=1S/C22H19BrClNO4/c1-29-19-9-11(6-15(23)22(19)28)14-10-20(27)25-17-7-12(8-18(26)21(14)17)13-4-2-3-5-16(13)24/h2-6,9,12,14,28H,7-8,10H2,1H3,(H,25,27)/t12-,14+/m1/s1 |
| InChIKey | PPUQCOVGSSLGEV-OCCSQVGLSA-N |
| XLogP | 4.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |