C22H30N4O4S — CID 41134731
N'-[2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 41134731) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is N'-[2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-[2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 41134731 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N'-[2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CC(=O)NNC(=O)c1cc3c(s1)CCCC3)C2=O |
| InChI | InChI=1S/C22H30N4O4S/c1-13-9-21(2,3)12-22(10-13)19(29)26(20(30)23-22)11-17(27)24-25-18(28)16-8-14-6-4-5-7-15(14)31-16/h8,13H,4-7,9-12H2,1-3H3,(H,23,30)(H,24,27)(H,25,28)/t13-,22-/m1/s1 |
| InChIKey | UGMCYQCFUCNQOE-MCMMXHMISA-N |
| XLogP | 2.52 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|