C22H19ClN4O2S2 — CID 41135312
10-[(1S)-1-[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethyl]sulfanyl-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 41135312) has the molecular formula C22H19ClN4O2S2 and a molecular weight of 471.01 g/mol. Its IUPAC name is 10-[(1S)-1-[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethyl]sulfanyl-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[(1S)-1-[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethyl]sulfanyl-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 41135312 |
| Molecular Formula | C22H19ClN4O2S2 |
| Molecular Weight | 471.01 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 10-[(1S)-1-[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethyl]sulfanyl-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | C=CCn1c(S[C@@H](C)c2nnc(-c3cccc(Cl)c3)o2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C22H19ClN4O2S2/c1-3-10-27-21(28)17-15-8-5-9-16(15)31-20(17)24-22(27)30-12(2)18-25-26-19(29-18)13-6-4-7-14(23)11-13/h3-4,6-7,11-12H,1,5,8-10H2,2H3/t12-/m0/s1 |
| InChIKey | CWKOFBLBNNCZNJ-LBPRGKRZSA-N |
| XLogP | 5.69 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.01 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|