C26H27N3O3S — CID 41139817
N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide (PubChem CID 41139817) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide.
| Compound Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 41139817 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
| SMILES | COc1ccc2c(c1)CCc1c(C(=O)Nc3sc4c(c3C#N)CC[C@H](C(C)(C)C)C4)noc1-2 |
| InChI | InChI=1S/C26H27N3O3S/c1-26(2,3)15-6-9-18-20(13-27)25(33-21(18)12-15)28-24(30)22-19-8-5-14-11-16(31-4)7-10-17(14)23(19)32-29-22/h7,10-11,15H,5-6,8-9,12H2,1-4H3,(H,28,30)/t15-/m0/s1 |
| InChIKey | WFZSOGLSFMECFP-HNNXBMFYSA-N |
| XLogP | 5.79 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |