About sodium 2-methoxyacetate
sodium 2-methoxyacetate (PubChem CID 4114130) has the molecular formula C3H5NaO3
and a molecular weight of 112.06 g/mol. Its IUPAC name is sodium 2-methoxyacetate.
Molecular Properties
| Compound Name | sodium 2-methoxyacetate |
| PubChem CID | 4114130 |
| Molecular Formula | C3H5NaO3 |
| Molecular Weight | 112.06 g/mol |
| Exact Mass | 112.01 |
| IUPAC Name | sodium 2-methoxyacetate |
| SMILES | COCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3.Na/c1-6-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 |
| InChIKey | CEWQOBFWNPUNRO-UHFFFAOYSA-M |
| XLogP | -4.61 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.06 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methoxyacetate?
The IUPAC name of sodium 2-methoxyacetate (CID 4114130) is sodium 2-methoxyacetate.
What is the SMILES notation for sodium 2-methoxyacetate?
The canonical SMILES for sodium 2-methoxyacetate is COCC(=O)[O-].[Na+].
What is the InChIKey of sodium 2-methoxyacetate?
The InChIKey is CEWQOBFWNPUNRO-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.Na/c1-6-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1.
What are the key properties of sodium 2-methoxyacetate?
sodium 2-methoxyacetate has a molecular weight of 112.06 g/mol, XLogP of -4.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methoxyacetate is sourced from PubChem (CID 4114130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).