2-methoxyacetic acid

C3H6O3 — CID 12251

IUPAC2-methoxyacetic acid
SMILESCOCC(=O)O
InChIInChI=1S/C3H6O3/c1-6-2-3(4)5/h2H2,1H3,(H,4,5)
InChIKeyRMIODHQZRUFFFF-UHFFFAOYSA-N
MW90.08 g/mol
LogP-0.28
Rot. Bonds2

About 2-methoxyacetic acid

2-methoxyacetic acid (PubChem CID 12251) has the molecular formula C3H6O3 and a molecular weight of 90.08 g/mol. Its IUPAC name is 2-methoxyacetic acid.

Molecular Properties

Compound Name2-methoxyacetic acid
PubChem CID12251
Molecular FormulaC3H6O3
Molecular Weight90.08 g/mol
Exact Mass90.03
IUPAC Name2-methoxyacetic acid
SMILESCOCC(=O)O
InChIInChI=1S/C3H6O3/c1-6-2-3(4)5/h2H2,1H3,(H,4,5)
InChIKeyRMIODHQZRUFFFF-UHFFFAOYSA-N
XLogP-0.28
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms6
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50090.08
LogP ≤ 5-0.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-methoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxyacetic acid?
The IUPAC name of 2-methoxyacetic acid (CID 12251) is 2-methoxyacetic acid.
What is the SMILES notation for 2-methoxyacetic acid?
The canonical SMILES for 2-methoxyacetic acid is COCC(=O)O.
What is the InChIKey of 2-methoxyacetic acid?
The InChIKey is RMIODHQZRUFFFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3/c1-6-2-3(4)5/h2H2,1H3,(H,4,5).
What are the key properties of 2-methoxyacetic acid?
2-methoxyacetic acid has a molecular weight of 90.08 g/mol, XLogP of -0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyacetic acid is sourced from PubChem (CID 12251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).