C25H27ClN4O3 — CID 4115893
6-benzoyl-N-(4-chloro-2-methylphenyl)-5-[(2-cyanoacetyl)hydrazinylidene]octanamide (PubChem CID 4115893) has the molecular formula C25H27ClN4O3 and a molecular weight of 466.97 g/mol. Its IUPAC name is 6-benzoyl-N-(4-chloro-2-methylphenyl)-5-[(2-cyanoacetyl)hydrazinylidene]octanamide.
| Compound Name | 6-benzoyl-N-(4-chloro-2-methylphenyl)-5-[(2-cyanoacetyl)hydrazinylidene]octanamide |
|---|---|
| PubChem CID | 4115893 |
| Molecular Formula | C25H27ClN4O3 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 6-benzoyl-N-(4-chloro-2-methylphenyl)-5-[(2-cyanoacetyl)hydrazinylidene]octanamide |
| SMILES | CCC(C(=O)c1ccccc1)C(CCCC(=O)Nc1ccc(Cl)cc1C)=NNC(=O)CC#N |
| InChI | InChI=1S/C25H27ClN4O3/c1-3-20(25(33)18-8-5-4-6-9-18)22(29-30-24(32)14-15-27)10-7-11-23(31)28-21-13-12-19(26)16-17(21)2/h4-6,8-9,12-13,16,20H,3,7,10-11,14H2,1-2H3,(H,28,31)(H,30,32) |
| InChIKey | LGVBOCWNLHSZQF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|