C24H22ClNO6S — CID 41164066
[2-[5-chloro-2-(4-methylphenoxy)anilino]-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 41164066) has the molecular formula C24H22ClNO6S and a molecular weight of 487.96 g/mol. Its IUPAC name is [2-[5-chloro-2-(4-methylphenoxy)anilino]-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [2-[5-chloro-2-(4-methylphenoxy)anilino]-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 41164066 |
| Molecular Formula | C24H22ClNO6S |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | [2-[5-chloro-2-(4-methylphenoxy)anilino]-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(Oc2ccc(Cl)cc2NC(=O)COC(=O)c2cc(S(C)(=O)=O)ccc2C)cc1 |
| InChI | InChI=1S/C24H22ClNO6S/c1-15-4-8-18(9-5-15)32-22-11-7-17(25)12-21(22)26-23(27)14-31-24(28)20-13-19(33(3,29)30)10-6-16(20)2/h4-13H,14H2,1-3H3,(H,26,27) |
| InChIKey | QOYCKZYELBJVHO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |