C21H23Cl3N2O3 — CID 41165177
(2S)-2-methyl-N-(2-methylphenyl)-2-[[(2S)-2-(2,4,5-trichlorophenoxy)propanoyl]amino]butanamide (PubChem CID 41165177) has the molecular formula C21H23Cl3N2O3 and a molecular weight of 457.79 g/mol. Its IUPAC name is (2S)-2-methyl-N-(2-methylphenyl)-2-[[(2S)-2-(2,4,5-trichlorophenoxy)propanoyl]amino]butanamide.
| Compound Name | (2S)-2-methyl-N-(2-methylphenyl)-2-[[(2S)-2-(2,4,5-trichlorophenoxy)propanoyl]amino]butanamide |
|---|---|
| PubChem CID | 41165177 |
| Molecular Formula | C21H23Cl3N2O3 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | (2S)-2-methyl-N-(2-methylphenyl)-2-[[(2S)-2-(2,4,5-trichlorophenoxy)propanoyl]amino]butanamide |
| SMILES | CC[C@](C)(NC(=O)[C@H](C)Oc1cc(Cl)c(Cl)cc1Cl)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C21H23Cl3N2O3/c1-5-21(4,20(28)25-17-9-7-6-8-12(17)2)26-19(27)13(3)29-18-11-15(23)14(22)10-16(18)24/h6-11,13H,5H2,1-4H3,(H,25,28)(H,26,27)/t13-,21-/m0/s1 |
| InChIKey | NNBGAHBNUFDBGX-ZSEKCTLFSA-N |
| XLogP | 5.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|