C25H26N4O3 — CID 41166837
N-[(1R)-1,2-bis(4-methoxyphenyl)ethyl]-1-ethylbenzotriazole-5-carboxamide (PubChem CID 41166837) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[(1R)-1,2-bis(4-methoxyphenyl)ethyl]-1-ethylbenzotriazole-5-carboxamide.
| Compound Name | N-[(1R)-1,2-bis(4-methoxyphenyl)ethyl]-1-ethylbenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 41166837 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[(1R)-1,2-bis(4-methoxyphenyl)ethyl]-1-ethylbenzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)N[C@H](Cc3ccc(OC)cc3)c3ccc(OC)cc3)ccc21 |
| InChI | InChI=1S/C25H26N4O3/c1-4-29-24-14-9-19(16-23(24)27-28-29)25(30)26-22(18-7-12-21(32-3)13-8-18)15-17-5-10-20(31-2)11-6-17/h5-14,16,22H,4,15H2,1-3H3,(H,26,30)/t22-/m1/s1 |
| InChIKey | SVTJPAJMXZXBBM-JOCHJYFZSA-N |
| XLogP | 4.18 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |