C24H23FN4O — CID 26192842
1-ethyl-N-[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]benzotriazole-5-carboxamide (PubChem CID 26192842) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-ethyl-N-[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 26192842 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-ethyl-N-[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]benzotriazole-5-carboxamide |
| SMILES | CCc1ccc([C@H](NC(=O)c2ccc3c(c2)nnn3CC)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H23FN4O/c1-3-16-8-10-17(11-9-16)23(18-6-5-7-20(25)14-18)26-24(30)19-12-13-22-21(15-19)27-28-29(22)4-2/h5-15,23H,3-4H2,1-2H3,(H,26,30)/t23-/m0/s1 |
| InChIKey | CMCIFZMCLRVEBN-QHCPKHFHSA-N |
| XLogP | 4.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |