C24H21NO8 — CID 41178785
(7-methoxy-2-oxochromen-4-yl)methyl 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 41178785) has the molecular formula C24H21NO8 and a molecular weight of 451.43 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 41178785 |
| Molecular Formula | C24H21NO8 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)OCc3cc(=O)oc4cc(OC)ccc34)cc2C1=O |
| InChI | InChI=1S/C24H21NO8/c1-30-9-3-8-25-22(27)18-6-4-14(10-19(18)23(25)28)24(29)32-13-15-11-21(26)33-20-12-16(31-2)5-7-17(15)20/h4-7,10-12H,3,8-9,13H2,1-2H3 |
| InChIKey | HXZGQAFZBXAHLV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|