C22H18N2O7 — CID 33070032
(7-methoxy-2-oxochromen-4-yl)methyl 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 33070032) has the molecular formula C22H18N2O7 and a molecular weight of 422.39 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 33070032 |
| Molecular Formula | C22H18N2O7 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | COc1ccc2c(COC(=O)c3cccc(CN4C(=O)CNC4=O)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H18N2O7/c1-29-16-5-6-17-15(8-20(26)31-18(17)9-16)12-30-21(27)14-4-2-3-13(7-14)11-24-19(25)10-23-22(24)28/h2-9H,10-12H2,1H3,(H,23,28) |
| InChIKey | WEGJYDDFZPUUHX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|