C25H23BrN2O2S — CID 4118280
N-[2-[3-[(4-bromophenyl)methylsulfanyl]indol-1-yl]ethyl]-4-methoxybenzamide (PubChem CID 4118280) has the molecular formula C25H23BrN2O2S and a molecular weight of 495.44 g/mol. Its IUPAC name is N-[2-[3-[(4-bromophenyl)methylsulfanyl]indol-1-yl]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[3-[(4-bromophenyl)methylsulfanyl]indol-1-yl]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4118280 |
| Molecular Formula | C25H23BrN2O2S |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-[2-[3-[(4-bromophenyl)methylsulfanyl]indol-1-yl]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCn2cc(SCc3ccc(Br)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H23BrN2O2S/c1-30-21-12-8-19(9-13-21)25(29)27-14-15-28-16-24(22-4-2-3-5-23(22)28)31-17-18-6-10-20(26)11-7-18/h2-13,16H,14-15,17H2,1H3,(H,27,29) |
| InChIKey | FQRHANHUMJBSQG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |