C16H11Br2N3O3 — CID 4121796
5-bromo-N-[(5-bromo-2-hydroxy-7-methyl-1H-indol-3-yl)imino]-2-hydroxybenzamide (PubChem CID 4121796) has the molecular formula C16H11Br2N3O3 and a molecular weight of 453.09 g/mol. Its IUPAC name is 5-bromo-N-[(5-bromo-2-hydroxy-7-methyl-1H-indol-3-yl)imino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(5-bromo-2-hydroxy-7-methyl-1H-indol-3-yl)imino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 4121796 |
| Molecular Formula | C16H11Br2N3O3 |
| Molecular Weight | 453.09 g/mol |
| Exact Mass | 450.92 |
| IUPAC Name | 5-bromo-N-[(5-bromo-2-hydroxy-7-methyl-1H-indol-3-yl)imino]-2-hydroxybenzamide |
| SMILES | Cc1cc(Br)cc2c(/N=N/C(=O)c3cc(Br)ccc3O)c(O)[nH]c12 |
| InChI | InChI=1S/C16H11Br2N3O3/c1-7-4-9(18)6-11-13(7)19-16(24)14(11)20-21-15(23)10-5-8(17)2-3-12(10)22/h2-6,19,22,24H,1H3/b21-20+ |
| InChIKey | UGRRSFIGJJYXIL-QZQOTICOSA-N |
| XLogP | 5.34 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|