C19H17Br2N3O2 — CID 4571048
4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide (PubChem CID 4571048) has the molecular formula C19H17Br2N3O2 and a molecular weight of 479.17 g/mol. Its IUPAC name is 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide.
| Compound Name | 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide |
|---|---|
| PubChem CID | 4571048 |
| Molecular Formula | C19H17Br2N3O2 |
| Molecular Weight | 479.17 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)/N=N/c2c(O)[nH]c3c(Br)cc(Br)cc23)cc1 |
| InChI | InChI=1S/C19H17Br2N3O2/c1-19(2,3)11-6-4-10(5-7-11)17(25)24-23-16-13-8-12(20)9-14(21)15(13)22-18(16)26/h4-9,22,26H,1-3H3/b24-23+ |
| InChIKey | CKYDTNCKIZQSSO-WCWDXBQESA-N |
| XLogP | 6.62 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.17 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|