About 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide
4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide (PubChem CID 4571048) has the molecular formula C19H17Br2N3O2
and a molecular weight of 479.17 g/mol. Its IUPAC name is 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide |
| PubChem CID | 4571048 |
| Molecular Formula | C19H17Br2N3O2 |
| Molecular Weight | 479.17 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)/N=N/c2c(O)[nH]c3c(Br)cc(Br)cc23)cc1 |
| InChI | InChI=1S/C19H17Br2N3O2/c1-19(2,3)11-6-4-10(5-7-11)17(25)24-23-16-13-8-12(20)9-14(21)15(13)22-18(16)26/h4-9,22,26H,1-3H3/b24-23+ |
| InChIKey | CKYDTNCKIZQSSO-WCWDXBQESA-N |
| XLogP | 6.62 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.17 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide?
The IUPAC name of 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide (CID 4571048) is 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide.
What is the SMILES notation for 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide?
The canonical SMILES for 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide is CC(C)(C)c1ccc(C(=O)/N=N/c2c(O)[nH]c3c(Br)cc(Br)cc23)cc1.
What is the InChIKey of 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide?
The InChIKey is CKYDTNCKIZQSSO-WCWDXBQESA-N. The full InChI is InChI=1S/C19H17Br2N3O2/c1-19(2,3)11-6-4-10(5-7-11)17(25)24-23-16-13-8-12(20)9-14(21)15(13)22-18(16)26/h4-9,22,26H,1-3H3/b24-23+.
What are the key properties of 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide?
4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide has a molecular weight of 479.17 g/mol, XLogP of 6.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]benzamide is sourced from PubChem (CID 4571048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).