C21H23Cl2N3O2 — CID 4122824
3-[2-(4-tert-butylbenzoyl)hydrazinyl]-N-(3,4-dichlorophenyl)but-2-enamide (PubChem CID 4122824) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 3-[2-(4-tert-butylbenzoyl)hydrazinyl]-N-(3,4-dichlorophenyl)but-2-enamide.
| Compound Name | 3-[2-(4-tert-butylbenzoyl)hydrazinyl]-N-(3,4-dichlorophenyl)but-2-enamide |
|---|---|
| PubChem CID | 4122824 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-[2-(4-tert-butylbenzoyl)hydrazinyl]-N-(3,4-dichlorophenyl)but-2-enamide |
| SMILES | CC(=CC(=O)Nc1ccc(Cl)c(Cl)c1)NNC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c1-13(11-19(27)24-16-9-10-17(22)18(23)12-16)25-26-20(28)14-5-7-15(8-6-14)21(2,3)4/h5-12,25H,1-4H3,(H,24,27)(H,26,28) |
| InChIKey | FJZUGCYZCHLQQQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|