C17H22N4OS — CID 4123765
N-[(pyridin-2-ylamino)carbamothioyl]adamantane-1-carboxamide (PubChem CID 4123765) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is N-[(pyridin-2-ylamino)carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[(pyridin-2-ylamino)carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4123765 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[(pyridin-2-ylamino)carbamothioyl]adamantane-1-carboxamide |
| SMILES | O=C(NC(=S)NNc1ccccn1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H22N4OS/c22-15(19-16(23)21-20-14-3-1-2-4-18-14)17-8-11-5-12(9-17)7-13(6-11)10-17/h1-4,11-13H,5-10H2,(H,18,20)(H2,19,21,22,23) |
| InChIKey | ZHGRAUQNQDPPAA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|