C22H21F2N3O5S — CID 41256106
2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide (PubChem CID 41256106) has the molecular formula C22H21F2N3O5S and a molecular weight of 477.49 g/mol. Its IUPAC name is 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide.
| Compound Name | 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 41256106 |
| Molecular Formula | C22H21F2N3O5S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
| SMILES | C[C@@]1(c2cc(F)ccc2F)NC(=O)N(CC(=O)N(c2ccccc2)[C@H]2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C22H21F2N3O5S/c1-22(17-11-14(23)7-8-18(17)24)20(29)26(21(30)25-22)12-19(28)27(15-5-3-2-4-6-15)16-9-10-33(31,32)13-16/h2-8,11,16H,9-10,12-13H2,1H3,(H,25,30)/t16-,22-/m0/s1 |
| InChIKey | QIWLLMBVMFYSIM-AOMKIAJQSA-N |
| XLogP | 1.95 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|