C21H24FN3O3S — CID 41256126
N-[(S)-cyclopropyl(phenyl)methyl]-4-(3-fluorophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 41256126) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[(S)-cyclopropyl(phenyl)methyl]-4-(3-fluorophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-[(S)-cyclopropyl(phenyl)methyl]-4-(3-fluorophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 41256126 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[(S)-cyclopropyl(phenyl)methyl]-4-(3-fluorophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | O=C(N[C@H](c1ccccc1)C1CC1)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H24FN3O3S/c22-18-7-4-8-19(15-18)29(27,28)25-13-11-24(12-14-25)21(26)23-20(17-9-10-17)16-5-2-1-3-6-16/h1-8,15,17,20H,9-14H2,(H,23,26)/t20-/m1/s1 |
| InChIKey | QVBPNMHNHKVSFC-HXUWFJFHSA-N |
| XLogP | 2.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |