C16H25N3O2S — CID 41256525
1-(2,3-dimethoxyphenyl)-3-[[(3R)-1-methylpiperidin-3-yl]methyl]thiourea (PubChem CID 41256525) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-[[(3R)-1-methylpiperidin-3-yl]methyl]thiourea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-[[(3R)-1-methylpiperidin-3-yl]methyl]thiourea |
|---|---|
| PubChem CID | 41256525 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-[[(3R)-1-methylpiperidin-3-yl]methyl]thiourea |
| SMILES | COc1cccc(NC(=S)NC[C@H]2CCCN(C)C2)c1OC |
| InChI | InChI=1S/C16H25N3O2S/c1-19-9-5-6-12(11-19)10-17-16(22)18-13-7-4-8-14(20-2)15(13)21-3/h4,7-8,12H,5-6,9-11H2,1-3H3,(H2,17,18,22)/t12-/m1/s1 |
| InChIKey | YEFZHVOUGJSOPY-GFCCVEGCSA-N |
| XLogP | 2.33 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|