C22H19ClF2N4O3S — CID 4125898
N-(4-chloro-2-fluorophenyl)-2-fluoro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 4125898) has the molecular formula C22H19ClF2N4O3S and a molecular weight of 492.94 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-fluoro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-fluoro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 4125898 |
| Molecular Formula | C22H19ClF2N4O3S |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-fluoro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)c1cc(S(=O)(=O)N2CCN(c3ccccn3)CC2)ccc1F |
| InChI | InChI=1S/C22H19ClF2N4O3S/c23-15-4-7-20(19(25)13-15)27-22(30)17-14-16(5-6-18(17)24)33(31,32)29-11-9-28(10-12-29)21-3-1-2-8-26-21/h1-8,13-14H,9-12H2,(H,27,30) |
| InChIKey | PNZFMZPKFSZYEJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |