C15H22N6O — CID 41260428
6-[(1S)-1-(4-ethoxyanilino)ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 41260428) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is 6-[(1S)-1-(4-ethoxyanilino)ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(1S)-1-(4-ethoxyanilino)ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 41260428 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 6-[(1S)-1-(4-ethoxyanilino)ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1ccc(N[C@@H](C)c2nc(N)nc(N(C)C)n2)cc1 |
| InChI | InChI=1S/C15H22N6O/c1-5-22-12-8-6-11(7-9-12)17-10(2)13-18-14(16)20-15(19-13)21(3)4/h6-10,17H,5H2,1-4H3,(H2,16,18,19,20)/t10-/m0/s1 |
| InChIKey | AWVCMXFLVSEMCX-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|