C18H27N7 — CID 40808769
2-N,2-N-dimethyl-6-[(1S)-1-(4-piperidin-1-ylanilino)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 40808769) has the molecular formula C18H27N7 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[(1S)-1-(4-piperidin-1-ylanilino)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[(1S)-1-(4-piperidin-1-ylanilino)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 40808769 |
| Molecular Formula | C18H27N7 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[(1S)-1-(4-piperidin-1-ylanilino)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@H](Nc1ccc(N2CCCCC2)cc1)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C18H27N7/c1-13(16-21-17(19)23-18(22-16)24(2)3)20-14-7-9-15(10-8-14)25-11-5-4-6-12-25/h7-10,13,20H,4-6,11-12H2,1-3H3,(H2,19,21,22,23)/t13-/m0/s1 |
| InChIKey | XWYSYXQCNBNTRN-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|