C19H17Cl2N3S — CID 41265818
3-benzyl-5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-4-phenyl-1,2,4-triazole (PubChem CID 41265818) has the molecular formula C19H17Cl2N3S and a molecular weight of 390.34 g/mol. Its IUPAC name is 3-benzyl-5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-benzyl-5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 41265818 |
| Molecular Formula | C19H17Cl2N3S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-benzyl-5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-4-phenyl-1,2,4-triazole |
| SMILES | ClC1(Cl)C[C@H]1CSc1nnc(Cc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C19H17Cl2N3S/c20-19(21)12-15(19)13-25-18-23-22-17(11-14-7-3-1-4-8-14)24(18)16-9-5-2-6-10-16/h1-10,15H,11-13H2/t15-/m0/s1 |
| InChIKey | CDBNQYLZHYPXPM-HNNXBMFYSA-N |
| XLogP | 5.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|