C26H25N3O4S — CID 41267765
N-(2-methoxyphenyl)-2-methyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)benzenesulfonamide (PubChem CID 41267765) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-methyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)benzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-2-methyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 41267765 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-(2-methoxyphenyl)-2-methyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)ccc1C |
| InChI | InChI=1S/C26H25N3O4S/c1-17-11-12-18(15-25(17)34(31,32)28-23-9-5-6-10-24(23)33-2)26(30)29-14-13-22-20(16-29)19-7-3-4-8-21(19)27-22/h3-12,15,27-28H,13-14,16H2,1-2H3 |
| InChIKey | CFTVVECRNMYOMW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|