C8H14N2S — CID 4127837
3-methyl-1,1-bis(prop-2-enyl)thiourea (PubChem CID 4127837) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 3-methyl-1,1-bis(prop-2-enyl)thiourea.
| Compound Name | 3-methyl-1,1-bis(prop-2-enyl)thiourea |
|---|---|
| PubChem CID | 4127837 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-methyl-1,1-bis(prop-2-enyl)thiourea |
| SMILES | C=CCN(CC=C)C(=S)NC |
| InChI | InChI=1S/C8H14N2S/c1-4-6-10(7-5-2)8(11)9-3/h4-5H,1-2,6-7H2,3H3,(H,9,11) |
| InChIKey | HYIBKVPMENMFFM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|