C19H25ClN4O3 — CID 41281654
(2R)-2-[2-(2-chloroanilino)-2-oxoethyl]-N-cyclohexyl-3-oxopiperazine-1-carboxamide (PubChem CID 41281654) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is (2R)-2-[2-(2-chloroanilino)-2-oxoethyl]-N-cyclohexyl-3-oxopiperazine-1-carboxamide.
| Compound Name | (2R)-2-[2-(2-chloroanilino)-2-oxoethyl]-N-cyclohexyl-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 41281654 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (2R)-2-[2-(2-chloroanilino)-2-oxoethyl]-N-cyclohexyl-3-oxopiperazine-1-carboxamide |
| SMILES | O=C(C[C@@H]1C(=O)NCCN1C(=O)NC1CCCCC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H25ClN4O3/c20-14-8-4-5-9-15(14)23-17(25)12-16-18(26)21-10-11-24(16)19(27)22-13-6-2-1-3-7-13/h4-5,8-9,13,16H,1-3,6-7,10-12H2,(H,21,26)(H,22,27)(H,23,25)/t16-/m1/s1 |
| InChIKey | SCCWJBZNYFVCLT-MRXNPFEDSA-N |
| XLogP | 2.51 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |