C18H21ClN4O3S — CID 41287111
4-(3-chlorophenyl)sulfonyl-N-[(1R)-1-pyridin-3-ylethyl]piperazine-1-carboxamide (PubChem CID 41287111) has the molecular formula C18H21ClN4O3S and a molecular weight of 408.91 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonyl-N-[(1R)-1-pyridin-3-ylethyl]piperazine-1-carboxamide.
| Compound Name | 4-(3-chlorophenyl)sulfonyl-N-[(1R)-1-pyridin-3-ylethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 41287111 |
| Molecular Formula | C18H21ClN4O3S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonyl-N-[(1R)-1-pyridin-3-ylethyl]piperazine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1)c1cccnc1 |
| InChI | InChI=1S/C18H21ClN4O3S/c1-14(15-4-3-7-20-13-15)21-18(24)22-8-10-23(11-9-22)27(25,26)17-6-2-5-16(19)12-17/h2-7,12-14H,8-11H2,1H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | IHUDKYDAQTWSKY-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |