C24H18N2O9 — CID 41302237
(2S,3R)-2,3-dibenzoyloxy-4-(3-nitroanilino)-4-oxobutanoic acid (PubChem CID 41302237) has the molecular formula C24H18N2O9 and a molecular weight of 478.41 g/mol. Its IUPAC name is (2S,3R)-2,3-dibenzoyloxy-4-(3-nitroanilino)-4-oxobutanoic acid.
| Compound Name | (2S,3R)-2,3-dibenzoyloxy-4-(3-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 41302237 |
| Molecular Formula | C24H18N2O9 |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | (2S,3R)-2,3-dibenzoyloxy-4-(3-nitroanilino)-4-oxobutanoic acid |
| SMILES | O=C(O[C@H](C(=O)O)[C@@H](OC(=O)c1ccccc1)C(=O)Nc1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C24H18N2O9/c27-21(25-17-12-7-13-18(14-17)26(32)33)19(34-23(30)15-8-3-1-4-9-15)20(22(28)29)35-24(31)16-10-5-2-6-11-16/h1-14,19-20H,(H,25,27)(H,28,29)/t19-,20+/m1/s1 |
| InChIKey | JGFLZTVUTVTXKB-UXHICEINSA-N |
| XLogP | 3.07 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|