C19H12F3N3O4S — CID 4136431
2-[2-[5-hydroxy-3-naphthalen-2-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-4-oxo-1,3-thiazol-5-ylidene]acetic acid (PubChem CID 4136431) has the molecular formula C19H12F3N3O4S and a molecular weight of 435.38 g/mol. Its IUPAC name is 2-[2-[5-hydroxy-3-naphthalen-2-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-4-oxo-1,3-thiazol-5-ylidene]acetic acid.
| Compound Name | 2-[2-[5-hydroxy-3-naphthalen-2-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-4-oxo-1,3-thiazol-5-ylidene]acetic acid |
|---|---|
| PubChem CID | 4136431 |
| Molecular Formula | C19H12F3N3O4S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-[2-[5-hydroxy-3-naphthalen-2-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-4-oxo-1,3-thiazol-5-ylidene]acetic acid |
| SMILES | O=C(O)C=C1SC(N2N=C(c3ccc4ccccc4c3)CC2(O)C(F)(F)F)=NC1=O |
| InChI | InChI=1S/C19H12F3N3O4S/c20-19(21,22)18(29)9-13(12-6-5-10-3-1-2-4-11(10)7-12)24-25(18)17-23-16(28)14(30-17)8-15(26)27/h1-8,29H,9H2,(H,26,27) |
| InChIKey | FVZSQQXRFWWFKS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|