C33H35N4O7P — CID 4137472
1-[tert-butyl-(3,5-dimethylbenzoyl)amino]-3-[diphenoxyphosphoryl-(3-nitrophenyl)methyl]urea (PubChem CID 4137472) has the molecular formula C33H35N4O7P and a molecular weight of 630.64 g/mol. Its IUPAC name is 1-[tert-butyl-(3,5-dimethylbenzoyl)amino]-3-[diphenoxyphosphoryl-(3-nitrophenyl)methyl]urea.
| Compound Name | 1-[tert-butyl-(3,5-dimethylbenzoyl)amino]-3-[diphenoxyphosphoryl-(3-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 4137472 |
| Molecular Formula | C33H35N4O7P |
| Molecular Weight | 630.64 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 1-[tert-butyl-(3,5-dimethylbenzoyl)amino]-3-[diphenoxyphosphoryl-(3-nitrophenyl)methyl]urea |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)NC(c2cccc([N+](=O)[O-])c2)P(=O)(Oc2ccccc2)Oc2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C33H35N4O7P/c1-23-19-24(2)21-26(20-23)31(38)36(33(3,4)5)35-32(39)34-30(25-13-12-14-27(22-25)37(40)41)45(42,43-28-15-8-6-9-16-28)44-29-17-10-7-11-18-29/h6-22,30H,1-5H3,(H2,34,35,39) |
| InChIKey | WOPIKGAJJWFHJE-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.64 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|