C21H24FN3O2 — CID 41375343
2-[ethyl-[(3-fluorophenyl)methyl]amino]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 41375343) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-[ethyl-[(3-fluorophenyl)methyl]amino]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-[ethyl-[(3-fluorophenyl)methyl]amino]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 41375343 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[ethyl-[(3-fluorophenyl)methyl]amino]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(N2CCCC2=O)c1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C21H24FN3O2/c1-2-24(14-16-6-3-7-17(22)12-16)15-20(26)23-18-8-4-9-19(13-18)25-11-5-10-21(25)27/h3-4,6-9,12-13H,2,5,10-11,14-15H2,1H3,(H,23,26) |
| InChIKey | QFLJWOAJPQLPKK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |