C10H9N7O — CID 4139717
2-[5-(2-cyanophenyl)tetrazol-2-yl]acetohydrazide (PubChem CID 4139717) has the molecular formula C10H9N7O and a molecular weight of 243.23 g/mol. Its IUPAC name is 2-[5-(2-cyanophenyl)tetrazol-2-yl]acetohydrazide.
| Compound Name | 2-[5-(2-cyanophenyl)tetrazol-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 4139717 |
| Molecular Formula | C10H9N7O |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-[5-(2-cyanophenyl)tetrazol-2-yl]acetohydrazide |
| SMILES | N#Cc1ccccc1-c1nnn(CC(=O)NN)n1 |
| InChI | InChI=1S/C10H9N7O/c11-5-7-3-1-2-4-8(7)10-14-16-17(15-10)6-9(18)13-12/h1-4H,6,12H2,(H,13,18) |
| InChIKey | YHSXXZMSWBTKRR-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|