C17H16F3N3O2 — CID 41397473
2-(2-phenylanilino)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 41397473) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-(2-phenylanilino)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-(2-phenylanilino)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 41397473 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-(2-phenylanilino)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | O=C(CNc1ccccc1-c1ccccc1)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C17H16F3N3O2/c18-17(19,20)11-22-16(25)23-15(24)10-21-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9,21H,10-11H2,(H2,22,23,24,25) |
| InChIKey | YYBSNSGCZVIAJH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |