C18H18F3N3O2 — CID 8596621
2-(benzhydrylamino)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 8596621) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 2-(benzhydrylamino)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-(benzhydrylamino)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8596621 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(benzhydrylamino)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | O=C(CNC(c1ccccc1)c1ccccc1)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O2/c19-18(20,21)12-23-17(26)24-15(25)11-22-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16,22H,11-12H2,(H2,23,24,25,26) |
| InChIKey | DCVMPDCFFSAHFU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |