C23H19NO4 — CID 41402254
2-[(1-oxo-2,3-dihydroinden-4-yl)oxy]-N-(4-phenoxyphenyl)acetamide (PubChem CID 41402254) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[(1-oxo-2,3-dihydroinden-4-yl)oxy]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[(1-oxo-2,3-dihydroinden-4-yl)oxy]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 41402254 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[(1-oxo-2,3-dihydroinden-4-yl)oxy]-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(COc1cccc2c1CCC2=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO4/c25-21-14-13-20-19(21)7-4-8-22(20)27-15-23(26)24-16-9-11-18(12-10-16)28-17-5-2-1-3-6-17/h1-12H,13-15H2,(H,24,26) |
| InChIKey | HCLNQLWZKPEWRA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |