C17H23NO5 — CID 41412128
N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-2,6-dimethoxybenzamide (PubChem CID 41412128) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 41412128 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC[C@H]1COC2(CCCC2)O1 |
| InChI | InChI=1S/C17H23NO5/c1-20-13-6-5-7-14(21-2)15(13)16(19)18-10-12-11-22-17(23-12)8-3-4-9-17/h5-7,12H,3-4,8-11H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | GAOIYGITSLDWCC-LBPRGKRZSA-N |
| XLogP | 2.12 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |