C20H28N2O6 — CID 16803906
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)oxamide (PubChem CID 16803906) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 16803906 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)NCC2COC3(CCCC3)O2)cc1OC |
| InChI | InChI=1S/C20H28N2O6/c1-25-16-6-5-14(11-17(16)26-2)7-10-21-18(23)19(24)22-12-15-13-27-20(28-15)8-3-4-9-20/h5-6,11,15H,3-4,7-10,12-13H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | JWXACGGTFJYCEP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|