C26H19N3O2S — CID 41427247
2-benzoyl-N-[4-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide (PubChem CID 41427247) has the molecular formula C26H19N3O2S and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-benzoyl-N-[4-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide.
| Compound Name | 2-benzoyl-N-[4-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 41427247 |
| Molecular Formula | C26H19N3O2S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-benzoyl-N-[4-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide |
| SMILES | Cc1csc2nc(-c3ccc(NC(=O)c4ccccc4C(=O)c4ccccc4)cc3)cn12 |
| InChI | InChI=1S/C26H19N3O2S/c1-17-16-32-26-28-23(15-29(17)26)18-11-13-20(14-12-18)27-25(31)22-10-6-5-9-21(22)24(30)19-7-3-2-4-8-19/h2-16H,1H3,(H,27,31) |
| InChIKey | SLUXQPPKYCMNIQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |