C19H16N4O3S2 — CID 7488144
N-[4-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-4-sulfamoylbenzamide (PubChem CID 7488144) has the molecular formula C19H16N4O3S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-[4-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-4-sulfamoylbenzamide.
| Compound Name | N-[4-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 7488144 |
| Molecular Formula | C19H16N4O3S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-[4-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-4-sulfamoylbenzamide |
| SMILES | Cc1csc2nc(-c3ccc(NC(=O)c4ccc(S(N)(=O)=O)cc4)cc3)cn12 |
| InChI | InChI=1S/C19H16N4O3S2/c1-12-11-27-19-22-17(10-23(12)19)13-2-6-15(7-3-13)21-18(24)14-4-8-16(9-5-14)28(20,25)26/h2-11H,1H3,(H,21,24)(H2,20,25,26) |
| InChIKey | UYLMHAHPQCNRCG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |