C29H32N4O4 — CID 41429505
2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-N-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-2-oxoacetamide (PubChem CID 41429505) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-N-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-2-oxoacetamide.
| Compound Name | 2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-N-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 41429505 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-N-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-2-oxoacetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(C(=O)C(=O)NCCc2cc3ccc(C)c(C)c3[nH]c2=O)c2ccccc21 |
| InChI | InChI=1S/C29H32N4O4/c1-5-32(6-2)25(34)17-33-16-23(22-9-7-8-10-24(22)33)27(35)29(37)30-14-13-21-15-20-12-11-18(3)19(4)26(20)31-28(21)36/h7-12,15-16H,5-6,13-14,17H2,1-4H3,(H,30,37)(H,31,36) |
| InChIKey | AMYHDDQNUCKUSI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|